ID | 2205 |
Name | Glaucine |
Pubchem ID | 16754 |
KEGG ID | C09446 |
Source | Platycapnos saxicola |
Type | Natural |
Function | Antitussive |
Drug Like Properties | Yes |
Molecular Weight | 355.43 |
Exact mass | 355.178358 |
Molecular formula | C21H25NO4 |
XlogP | 3.4 |
Topological Polar Surface Area | 40.2 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Suau,Biochem.Syst.Ecol.,32,(2004),565 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 2234 |
Name | Glaucine |
Pubchem ID | 16754 |
KEGG ID | C09446 |
Source | Platycapnos saxicola |
Type | Natural |
Function | Antioxidant |
Drug Like Properties | Yes |
Molecular Weight | 355.43 |
Exact mass | 355.178358 |
Molecular formula | C21H25NO4 |
XlogP | 3.4 |
Topological Polar Surface Area | 40.2 |
H-Bond Donor | 0 |
H-Bond Acceptor | 5 |
Rotational Bond Count | 4 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC)OC)OC |
Isomeric SMILE | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Suau,Biochem.Syst.Ecol.,32,(2004),565 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 3025 |
Name | Protopine |
Pubchem ID | 4970 |
KEGG ID | C05189 |
Source | Platycapnos saxicola |
Type | Natural |
Function | Antibacterial |
Drug Like Properties | Yes |
Molecular Weight | 353.37 |
Exact mass | 353.126323 |
Molecular formula | C20H19NO5 |
XlogP | 2.8 |
Topological Polar Surface Area | 57.2 |
H-Bond Donor | 0 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 0 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
Isomeric SMILE | N/A |
Drugpedia | wiki |
References | 1. Suau,Biochem.Syst.Ecol.,32,(2004),565 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |